C14H13N5O — CID 68773100
4-[3-(6-methoxy-3-pyridinyl)-1,2,4-triazol-1-yl]aniline (PubChem CID 68773100) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[3-(6-methoxy-3-pyridinyl)-1,2,4-triazol-1-yl]aniline.
| Compound Name | 4-[3-(6-methoxy-3-pyridinyl)-1,2,4-triazol-1-yl]aniline |
|---|---|
| PubChem CID | 68773100 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-[3-(6-methoxy-3-pyridinyl)-1,2,4-triazol-1-yl]aniline |
| SMILES | COc1ccc(-c2ncn(-c3ccc(N)cc3)n2)cn1 |
| InChI | InChI=1S/C14H13N5O/c1-20-13-7-2-10(8-16-13)14-17-9-19(18-14)12-5-3-11(15)4-6-12/h2-9H,15H2,1H3 |
| InChIKey | RWHIZUXWPBCCJY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|