C20H19N7O2 — CID 68774082
6-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-4-morpholin-4-ylpteridin-2-amine (PubChem CID 68774082) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 6-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-4-morpholin-4-ylpteridin-2-amine.
| Compound Name | 6-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-4-morpholin-4-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68774082 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 6-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-4-morpholin-4-ylpteridin-2-amine |
| SMILES | Cc1onc(-c2ccccc2)c1-c1cnc2nc(N)nc(N3CCOCC3)c2n1 |
| InChI | InChI=1S/C20H19N7O2/c1-12-15(16(26-29-12)13-5-3-2-4-6-13)14-11-22-18-17(23-14)19(25-20(21)24-18)27-7-9-28-10-8-27/h2-6,11H,7-10H2,1H3,(H2,21,22,24,25) |
| InChIKey | ZJWKLFBQEJSPRZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |