C19H19Cl2N3O2 — CID 6877586
N'-[(E)-(3,4-dichlorophenyl)methylideneamino]-N-(2,6-diethylphenyl)oxamide (PubChem CID 6877586) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is N'-[(E)-(3,4-dichlorophenyl)methylideneamino]-N-(2,6-diethylphenyl)oxamide.
| Compound Name | N'-[(E)-(3,4-dichlorophenyl)methylideneamino]-N-(2,6-diethylphenyl)oxamide |
|---|---|
| PubChem CID | 6877586 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N'-[(E)-(3,4-dichlorophenyl)methylideneamino]-N-(2,6-diethylphenyl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)N/N=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-3-13-6-5-7-14(4-2)17(13)23-18(25)19(26)24-22-11-12-8-9-15(20)16(21)10-12/h5-11H,3-4H2,1-2H3,(H,23,25)(H,24,26)/b22-11+ |
| InChIKey | NURBPWKVHOWODY-SSDVNMTOSA-N |
| XLogP | 4.21 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|