C21H22N4O4 — CID 68778767
7-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-3H-isoindol-1-one (PubChem CID 68778767) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 7-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-3H-isoindol-1-one.
| Compound Name | 7-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 68778767 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 7-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-(1,3,4-oxadiazol-2-yl)ethyl]-3H-isoindol-1-one |
| SMILES | CCOc1cc(C(Cc2nnco2)N2Cc3cccc(N)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H22N4O4/c1-3-28-18-9-13(7-8-17(18)27-2)16(10-19-24-23-12-29-19)25-11-14-5-4-6-15(22)20(14)21(25)26/h4-9,12,16H,3,10-11,22H2,1-2H3 |
| InChIKey | XHPXKFZIWCSIML-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|