C28H26Cl2F3N3O3S — CID 68779818
4,4-dichloro-N-(1-cyano-2-phenylethyl)-2-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]butanamide (PubChem CID 68779818) has the molecular formula C28H26Cl2F3N3O3S and a molecular weight of 612.50 g/mol. Its IUPAC name is 4,4-dichloro-N-(1-cyano-2-phenylethyl)-2-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]butanamide.
| Compound Name | 4,4-dichloro-N-(1-cyano-2-phenylethyl)-2-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]butanamide |
|---|---|
| PubChem CID | 68779818 |
| Molecular Formula | C28H26Cl2F3N3O3S |
| Molecular Weight | 612.50 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | 4,4-dichloro-N-(1-cyano-2-phenylethyl)-2-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]butanamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc([C@H](NC(CC(Cl)Cl)C(=O)NC(C#N)Cc3ccccc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H26Cl2F3N3O3S/c1-40(38,39)23-13-11-20(12-14-23)19-7-9-21(10-8-19)26(28(31,32)33)36-24(16-25(29)30)27(37)35-22(17-34)15-18-5-3-2-4-6-18/h2-14,22,24-26,36H,15-16H2,1H3,(H,35,37)/t22?,24?,26-/m0/s1 |
| InChIKey | UULSCOLFHVNVPK-GNCHDMCWSA-N |
| XLogP | 5.76 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|