About 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one
4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one (PubChem CID 68780891) has the molecular formula C16H14I2N2O
and a molecular weight of 504.11 g/mol. Its IUPAC name is 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one |
| PubChem CID | 68780891 |
| Molecular Formula | C16H14I2N2O |
| Molecular Weight | 504.11 g/mol |
| Exact Mass | 503.92 |
| IUPAC Name | 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one |
| SMILES | Cc1cc(=O)c2cc(I)ccc2[nH]1.Nc1ccc(I)cc1 |
| InChI | InChI=1S/C10H8INO.C6H6IN/c1-6-4-10(13)8-5-7(11)2-3-9(8)12-6;7-5-1-3-6(8)4-2-5/h2-5H,1H3,(H,12,13);1-4H,8H2 |
| InChIKey | KHWBLMPNBORKGH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.11 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one?
The IUPAC name of 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one (CID 68780891) is 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one.
What is the SMILES notation for 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one?
The canonical SMILES for 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one is Cc1cc(=O)c2cc(I)ccc2[nH]1.Nc1ccc(I)cc1.
What is the InChIKey of 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one?
The InChIKey is KHWBLMPNBORKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8INO.C6H6IN/c1-6-4-10(13)8-5-7(11)2-3-9(8)12-6;7-5-1-3-6(8)4-2-5/h2-5H,1H3,(H,12,13);1-4H,8H2.
What are the key properties of 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one?
4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one has a molecular weight of 504.11 g/mol, XLogP of 4.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodoaniline;6-iodo-2-methyl-1H-quinolin-4-one is sourced from PubChem (CID 68780891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).