C27H32N2O2 — CID 68782789
[5-[4-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]phenyl]isoindol-2-yl]-(oxan-4-yl)methanone (PubChem CID 68782789) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is [5-[4-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]phenyl]isoindol-2-yl]-(oxan-4-yl)methanone.
| Compound Name | [5-[4-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]phenyl]isoindol-2-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 68782789 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | [5-[4-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]phenyl]isoindol-2-yl]-(oxan-4-yl)methanone |
| SMILES | C[C@@H]1CCCN1CCc1ccc(-c2ccc3cn(C(=O)C4CCOCC4)cc3c2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-20-3-2-13-28(20)14-10-21-4-6-22(7-5-21)24-8-9-25-18-29(19-26(25)17-24)27(30)23-11-15-31-16-12-23/h4-9,17-20,23H,2-3,10-16H2,1H3/t20-/m1/s1 |
| InChIKey | JEHNQKJCGARRKG-HXUWFJFHSA-N |
| XLogP | 5.40 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |