C24H37N3O5 — CID 68783294
4-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 68783294) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 4-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 68783294 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 4-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | COCCCn1ncc2ccc(CC(CC(NC(=O)OC(C)(C)C)C(=O)O)C(C)C)cc21 |
| InChI | InChI=1S/C24H37N3O5/c1-16(2)19(14-20(22(28)29)26-23(30)32-24(3,4)5)12-17-8-9-18-15-25-27(21(18)13-17)10-7-11-31-6/h8-9,13,15-16,19-20H,7,10-12,14H2,1-6H3,(H,26,30)(H,28,29) |
| InChIKey | GFQNMKLIRLUOJI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|