C20H17BN2O4 — CID 68783755
[2,5-bis(phenylcarbamoyl)phenyl]boronic acid (PubChem CID 68783755) has the molecular formula C20H17BN2O4 and a molecular weight of 360.18 g/mol. Its IUPAC name is [2,5-bis(phenylcarbamoyl)phenyl]boronic acid.
| Compound Name | [2,5-bis(phenylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 68783755 |
| Molecular Formula | C20H17BN2O4 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [2,5-bis(phenylcarbamoyl)phenyl]boronic acid |
| SMILES | O=C(Nc1ccccc1)c1ccc(C(=O)Nc2ccccc2)c(B(O)O)c1 |
| InChI | InChI=1S/C20H17BN2O4/c24-19(22-15-7-3-1-4-8-15)14-11-12-17(18(13-14)21(26)27)20(25)23-16-9-5-2-6-10-16/h1-13,26-27H,(H,22,24)(H,23,25) |
| InChIKey | YPCVNXNZKGXJEE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|