C26H34N2O2 — CID 68784597
4-methoxy-1-[5-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,3-dihydroisoindol-2-yl]butan-1-one (PubChem CID 68784597) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-methoxy-1-[5-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,3-dihydroisoindol-2-yl]butan-1-one.
| Compound Name | 4-methoxy-1-[5-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,3-dihydroisoindol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 68784597 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 4-methoxy-1-[5-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,3-dihydroisoindol-2-yl]butan-1-one |
| SMILES | COCCCC(=O)N1Cc2ccc(-c3ccc(CCN4CCCC4C)cc3)cc2C1 |
| InChI | InChI=1S/C26H34N2O2/c1-20-5-3-14-27(20)15-13-21-7-9-22(10-8-21)23-11-12-24-18-28(19-25(24)17-23)26(29)6-4-16-30-2/h7-12,17,20H,3-6,13-16,18-19H2,1-2H3 |
| InChIKey | FKGJWDSFJBRSHE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|