C22H23Cl2NO2 — CID 68790293
2-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]propan-2-ol;hydrochloride (PubChem CID 68790293) has the molecular formula C22H23Cl2NO2 and a molecular weight of 404.34 g/mol. Its IUPAC name is 2-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]propan-2-ol;hydrochloride.
| Compound Name | 2-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 68790293 |
| Molecular Formula | C22H23Cl2NO2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]propan-2-ol;hydrochloride |
| SMILES | COc1ccc(Cc2ccc(C(C)(C)O)nc2)cc1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C22H22ClNO2.ClH/c1-22(2,25)21-10-8-16(14-24-21)11-15-7-9-20(26-3)19(12-15)17-5-4-6-18(23)13-17;/h4-10,12-14,25H,11H2,1-3H3;1H |
| InChIKey | DGFOKJCXJZARHT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |