C32H31FN4O2 — CID 68790408
1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-(2-hydroxyphenyl)urea (PubChem CID 68790408) has the molecular formula C32H31FN4O2 and a molecular weight of 522.62 g/mol. Its IUPAC name is 1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-(2-hydroxyphenyl)urea.
| Compound Name | 1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-(2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 68790408 |
| Molecular Formula | C32H31FN4O2 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-(2-hydroxyphenyl)urea |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CC(NC(=O)Nc2ccccc2O)c2ccccc2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H31FN4O2/c1-20-26-19-34-37(25-15-13-24(33)14-16-25)29(26)18-23-12-11-22(31(20)23)17-28(21-7-3-2-4-8-21)36-32(39)35-27-9-5-6-10-30(27)38/h2-10,13-16,19-20,22,28,38H,11-12,17-18H2,1H3,(H2,35,36,39)/t20-,22+,28?/m0/s1 |
| InChIKey | QHMNDTKYWLMOHM-FDBSDCMXSA-N |
| XLogP | 7.04 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|