C26H34FN3O — CID 66862293
(4R,5R)-1-(4-fluorophenyl)-4-methyl-N,N-bis(2-methylpropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66862293) has the molecular formula C26H34FN3O and a molecular weight of 423.58 g/mol. Its IUPAC name is (4R,5R)-1-(4-fluorophenyl)-4-methyl-N,N-bis(2-methylpropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-1-(4-fluorophenyl)-4-methyl-N,N-bis(2-methylpropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66862293 |
| Molecular Formula | C26H34FN3O |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | (4R,5R)-1-(4-fluorophenyl)-4-methyl-N,N-bis(2-methylpropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)[C@@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2 |
| InChI | InChI=1S/C26H34FN3O/c1-16(2)14-29(15-17(3)4)26(31)22-11-6-19-12-24-23(18(5)25(19)22)13-28-30(24)21-9-7-20(27)8-10-21/h7-10,13,16-18,22H,6,11-12,14-15H2,1-5H3/t18-,22+/m0/s1 |
| InChIKey | YUNVMMPQOQWRSV-PGRDOPGGSA-N |
| XLogP | 5.52 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|