C27H25F4N3O2 — CID 66861782
(4R,5R)-1-(4-fluorophenyl)-N-(2-hydroxyethyl)-4-methyl-N-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66861782) has the molecular formula C27H25F4N3O2 and a molecular weight of 499.51 g/mol. Its IUPAC name is (4R,5R)-1-(4-fluorophenyl)-N-(2-hydroxyethyl)-4-methyl-N-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-1-(4-fluorophenyl)-N-(2-hydroxyethyl)-4-methyl-N-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66861782 |
| Molecular Formula | C27H25F4N3O2 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (4R,5R)-1-(4-fluorophenyl)-N-(2-hydroxyethyl)-4-methyl-N-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | C[C@@H]1C2=C(CC[C@H]2C(=O)N(CCO)Cc2cc(F)c(F)c(F)c2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H25F4N3O2/c1-15-21-13-32-34(19-5-3-18(28)4-6-19)24(21)12-17-2-7-20(25(15)17)27(36)33(8-9-35)14-16-10-22(29)26(31)23(30)11-16/h3-6,10-11,13,15,20,35H,2,7-9,12,14H2,1H3/t15-,20+/m0/s1 |
| InChIKey | QRHAIWYPPOQWPF-MGPUTAFESA-N |
| XLogP | 4.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|