C27H25F4N3O — CID 66861362
(4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66861362) has the molecular formula C27H25F4N3O and a molecular weight of 483.51 g/mol. Its IUPAC name is (4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66861362 |
| Molecular Formula | C27H25F4N3O |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-[[3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | C[C@@H]1C2=C(CC[C@H]2C(=O)N(C)Cc2cccc(C(F)(F)F)c2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H25F4N3O/c1-16-23-14-32-34(21-9-7-20(28)8-10-21)24(23)13-18-6-11-22(25(16)18)26(35)33(2)15-17-4-3-5-19(12-17)27(29,30)31/h3-5,7-10,12,14,16,22H,6,11,13,15H2,1-2H3/t16-,22+/m0/s1 |
| InChIKey | IJROFZQYQURXGK-KSFYIVLOSA-N |
| XLogP | 6.05 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|