C27H28F4N4O3S — CID 67198822
2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxy-2-pyridin-4-ylethyl)ethanesulfonamide (PubChem CID 67198822) has the molecular formula C27H28F4N4O3S and a molecular weight of 564.61 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxy-2-pyridin-4-ylethyl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxy-2-pyridin-4-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 67198822 |
| Molecular Formula | C27H28F4N4O3S |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxy-2-pyridin-4-ylethyl)ethanesulfonamide |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CN(CC(O)c2ccncc2)S(=O)(=O)CC(F)(F)F)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28F4N4O3S/c1-17-23-13-33-35(22-6-4-21(28)5-7-22)24(23)12-19-2-3-20(26(17)19)14-34(39(37,38)16-27(29,30)31)15-25(36)18-8-10-32-11-9-18/h4-11,13,17,20,25,36H,2-3,12,14-16H2,1H3/t17-,20+,25?/m0/s1 |
| InChIKey | POVCMBOISSAIIW-VTAMTKRHSA-N |
| XLogP | 4.70 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|