C32H29FN4O2S — CID 87306167
N-(cyanomethyl)-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-2-phenylbenzenesulfonamide (PubChem CID 87306167) has the molecular formula C32H29FN4O2S and a molecular weight of 552.68 g/mol. Its IUPAC name is N-(cyanomethyl)-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-2-phenylbenzenesulfonamide.
| Compound Name | N-(cyanomethyl)-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-2-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 87306167 |
| Molecular Formula | C32H29FN4O2S |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | N-(cyanomethyl)-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-2-phenylbenzenesulfonamide |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CN(CC#N)S(=O)(=O)c2ccccc2-c2ccccc2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H29FN4O2S/c1-22-29-20-35-37(27-15-13-26(33)14-16-27)30(29)19-24-11-12-25(32(22)24)21-36(18-17-34)40(38,39)31-10-6-5-9-28(31)23-7-3-2-4-8-23/h2-10,13-16,20,22,25H,11-12,18-19,21H2,1H3/t22-,25+/m0/s1 |
| InChIKey | JTYLBYRUTNBJLU-WIOPSUGQSA-N |
| XLogP | 6.26 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|