C26H31FN4O4S — CID 67200214
N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-[(2R)-2-hydroxypropyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 67200214) has the molecular formula C26H31FN4O4S and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-[(2R)-2-hydroxypropyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-[(2R)-2-hydroxypropyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 67200214 |
| Molecular Formula | C26H31FN4O4S |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-[(2R)-2-hydroxypropyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C[C@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2)C[C@@H](C)O |
| InChI | InChI=1S/C26H31FN4O4S/c1-15(32)13-30(36(33,34)26-17(3)29-35-18(26)4)14-20-6-5-19-11-24-23(16(2)25(19)20)12-28-31(24)22-9-7-21(27)8-10-22/h7-10,12,15-16,20,32H,5-6,11,13-14H2,1-4H3/t15-,16+,20-/m1/s1 |
| InChIKey | NUHZXMOLSQTDTM-GQIGUUNPSA-N |
| XLogP | 4.05 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|