C23H28FN3O2 — CID 66862168
(4R,5R)-1-(4-fluorophenyl)-N-[(2R)-2-methoxypropyl]-N,4-dimethyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66862168) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is (4R,5R)-1-(4-fluorophenyl)-N-[(2R)-2-methoxypropyl]-N,4-dimethyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-1-(4-fluorophenyl)-N-[(2R)-2-methoxypropyl]-N,4-dimethyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66862168 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (4R,5R)-1-(4-fluorophenyl)-N-[(2R)-2-methoxypropyl]-N,4-dimethyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | CO[C@H](C)CN(C)C(=O)[C@@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2 |
| InChI | InChI=1S/C23H28FN3O2/c1-14(29-4)13-26(3)23(28)19-10-5-16-11-21-20(15(2)22(16)19)12-25-27(21)18-8-6-17(24)7-9-18/h6-9,12,14-15,19H,5,10-11,13H2,1-4H3/t14-,15+,19-/m1/s1 |
| InChIKey | ZBLRIVCCDZRDSC-ZRGWGRIASA-N |
| XLogP | 3.87 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|