C23H25F4N3O — CID 66863012
(4R,5R)-N-ethyl-1-(4-fluorophenyl)-4-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66863012) has the molecular formula C23H25F4N3O and a molecular weight of 435.47 g/mol. Its IUPAC name is (4R,5R)-N-ethyl-1-(4-fluorophenyl)-4-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-N-ethyl-1-(4-fluorophenyl)-4-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66863012 |
| Molecular Formula | C23H25F4N3O |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (4R,5R)-N-ethyl-1-(4-fluorophenyl)-4-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | CCN(CCC(F)(F)F)C(=O)[C@@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2 |
| InChI | InChI=1S/C23H25F4N3O/c1-3-29(11-10-23(25,26)27)22(31)18-9-4-15-12-20-19(14(2)21(15)18)13-28-30(20)17-7-5-16(24)6-8-17/h5-8,13-14,18H,3-4,9-12H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | AATGUUKBWDFSEB-KBXCAEBGSA-N |
| XLogP | 5.18 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|