C22H23F4N3O2 — CID 66861776
(4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66861776) has the molecular formula C22H23F4N3O2 and a molecular weight of 437.44 g/mol. Its IUPAC name is (4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66861776 |
| Molecular Formula | C22H23F4N3O2 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (4R,5R)-1-(4-fluorophenyl)-N,4-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | C[C@@H]1C2=C(CC[C@H]2C(=O)N(C)CC(O)C(F)(F)F)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23F4N3O2/c1-12-17-10-27-29(15-6-4-14(23)5-7-15)18(17)9-13-3-8-16(20(12)13)21(31)28(2)11-19(30)22(24,25)26/h4-7,10,12,16,19,30H,3,8-9,11H2,1-2H3/t12-,16+,19?/m0/s1 |
| InChIKey | YOTPKAVHUQOYQX-HAEBDUGBSA-N |
| XLogP | 3.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|