C28H26F5N3O2 — CID 66861879
(4R,5R)-1-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide (PubChem CID 66861879) has the molecular formula C28H26F5N3O2 and a molecular weight of 531.53 g/mol. Its IUPAC name is (4R,5R)-1-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide.
| Compound Name | (4R,5R)-1-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
|---|---|
| PubChem CID | 66861879 |
| Molecular Formula | C28H26F5N3O2 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (4R,5R)-1-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]-4-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazole-5-carboxamide |
| SMILES | C[C@@H]1C2=C(CC[C@H]2C(=O)N(Cc2ccccc2F)CC(O)C(F)(F)F)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H26F5N3O2/c1-16-22-13-34-36(20-9-7-19(29)8-10-20)24(22)12-17-6-11-21(26(16)17)27(38)35(15-25(37)28(31,32)33)14-18-4-2-3-5-23(18)30/h2-5,7-10,13,16,21,25,37H,6,11-12,14-15H2,1H3/t16-,21+,25?/m0/s1 |
| InChIKey | FQLWHJQDTQNBBU-AZULWTHOSA-N |
| XLogP | 5.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|