C25H28F7N3O5S2 — CID 87306853
[(2S)-1-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]propan-2-yl] 2,2,2-trifluoroethanesulfonate (PubChem CID 87306853) has the molecular formula C25H28F7N3O5S2 and a molecular weight of 647.64 g/mol. Its IUPAC name is [(2S)-1-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]propan-2-yl] 2,2,2-trifluoroethanesulfonate.
| Compound Name | [(2S)-1-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]propan-2-yl] 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 87306853 |
| Molecular Formula | C25H28F7N3O5S2 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | [(2S)-1-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]propan-2-yl] 2,2,2-trifluoroethanesulfonate |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CN(C[C@H](C)OS(=O)(=O)CC(F)(F)F)S(=O)(=O)CC(F)(F)F)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H28F7N3O5S2/c1-15(40-42(38,39)14-25(30,31)32)11-34(41(36,37)13-24(27,28)29)12-18-4-3-17-9-22-21(16(2)23(17)18)10-33-35(22)20-7-5-19(26)6-8-20/h5-8,10,15-16,18H,3-4,9,11-14H2,1-2H3/t15-,16-,18+/m0/s1 |
| InChIKey | UPMWFJOPFZCPLC-XYJFISCASA-N |
| XLogP | 4.87 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|