C34H33FN4O2S — CID 143860130
N-(cyanomethyl)-N-[2-[(9R,10R)-4-(4-fluorophenyl)-9-methyl-4,5-diazatricyclo[7.3.1.03,7]trideca-1,3(7),5-trien-10-yl]ethyl]-2-phenylbenzenesulfonamide (PubChem CID 143860130) has the molecular formula C34H33FN4O2S and a molecular weight of 580.73 g/mol. Its IUPAC name is N-(cyanomethyl)-N-[2-[(9R,10R)-4-(4-fluorophenyl)-9-methyl-4,5-diazatricyclo[7.3.1.03,7]trideca-1,3(7),5-trien-10-yl]ethyl]-2-phenylbenzenesulfonamide.
| Compound Name | N-(cyanomethyl)-N-[2-[(9R,10R)-4-(4-fluorophenyl)-9-methyl-4,5-diazatricyclo[7.3.1.03,7]trideca-1,3(7),5-trien-10-yl]ethyl]-2-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 143860130 |
| Molecular Formula | C34H33FN4O2S |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | N-(cyanomethyl)-N-[2-[(9R,10R)-4-(4-fluorophenyl)-9-methyl-4,5-diazatricyclo[7.3.1.03,7]trideca-1,3(7),5-trien-10-yl]ethyl]-2-phenylbenzenesulfonamide |
| SMILES | C[C@@]12CC(=Cc3c(cnn3-c3ccc(F)cc3)C1)CC[C@@H]2CCN(CC#N)S(=O)(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C34H33FN4O2S/c1-34-22-25(21-32-27(23-34)24-37-39(32)30-15-13-29(35)14-16-30)11-12-28(34)17-19-38(20-18-36)42(40,41)33-10-6-5-9-31(33)26-7-3-2-4-8-26/h2-10,13-16,21,24,28H,11-12,17,19-20,22-23H2,1H3/t28-,34-/m1/s1 |
| InChIKey | TZEHJZMYKZYQCZ-XQJOSWFISA-N |
| XLogP | 7.03 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|