C27H29FN2O2S — CID 143661871
1-ethyl-2-ethylsulfonylbenzene;6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene (PubChem CID 143661871) has the molecular formula C27H29FN2O2S and a molecular weight of 464.61 g/mol. Its IUPAC name is 1-ethyl-2-ethylsulfonylbenzene;6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene.
| Compound Name | 1-ethyl-2-ethylsulfonylbenzene;6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene |
|---|---|
| PubChem CID | 143661871 |
| Molecular Formula | C27H29FN2O2S |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-ethyl-2-ethylsulfonylbenzene;6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene |
| SMILES | CCc1ccccc1S(=O)(=O)CC.Fc1ccc(-n2ncc3c2C=C2CCC4CC24C3)cc1 |
| InChI | InChI=1S/C17H15FN2.C10H14O2S/c18-14-3-5-15(6-4-14)20-16-7-12-1-2-13-9-17(12,13)8-11(16)10-19-20;1-3-9-7-5-6-8-10(9)13(11,12)4-2/h3-7,10,13H,1-2,8-9H2;5-8H,3-4H2,1-2H3 |
| InChIKey | IFYIUEHWZCMPLY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |