C25H25N3O2 — CID 143661755
2-(hydroxymethyl)benzamide;(12R)-6-phenyl-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene (PubChem CID 143661755) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(hydroxymethyl)benzamide;(12R)-6-phenyl-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene.
| Compound Name | 2-(hydroxymethyl)benzamide;(12R)-6-phenyl-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene |
|---|---|
| PubChem CID | 143661755 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-(hydroxymethyl)benzamide;(12R)-6-phenyl-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-triene |
| SMILES | C1=C2CC[C@@H]3CC23Cc2cnn(-c3ccccc3)c21.NC(=O)c1ccccc1CO |
| InChI | InChI=1S/C17H16N2.C8H9NO2/c1-2-4-15(5-3-1)19-16-8-13-6-7-14-10-17(13,14)9-12(16)11-18-19;9-8(11)7-4-2-1-3-6(7)5-10/h1-5,8,11,14H,6-7,9-10H2;1-4,10H,5H2,(H2,9,11)/t14-,17?;/m1./s1 |
| InChIKey | QGHCYJSTPUJSBG-JOZUQTIUSA-N |
| XLogP | 3.89 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |