C28H28FN3O5S — CID 70973336
methyl 2-[[(1S,12R)-6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]methyl-(2-hydroxyethyl)sulfamoyl]benzoate (PubChem CID 70973336) has the molecular formula C28H28FN3O5S and a molecular weight of 537.61 g/mol. Its IUPAC name is methyl 2-[[(1S,12R)-6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]methyl-(2-hydroxyethyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[[(1S,12R)-6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]methyl-(2-hydroxyethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 70973336 |
| Molecular Formula | C28H28FN3O5S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | methyl 2-[[(1S,12R)-6-(4-fluorophenyl)-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]methyl-(2-hydroxyethyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N(CCO)C[C@@]12CCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]31C2 |
| InChI | InChI=1S/C28H28FN3O5S/c1-37-26(34)23-4-2-3-5-25(23)38(35,36)31(12-13-33)18-27-11-10-20-14-24-19(15-28(20,27)17-27)16-30-32(24)22-8-6-21(29)7-9-22/h2-9,14,16,33H,10-13,15,17-18H2,1H3/t27-,28+/m0/s1 |
| InChIKey | MAHSTXSRVQNWHF-WUFINQPMSA-N |
| XLogP | 3.59 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |