C12H16N2O6S — CID 68792270
[(2S)-1-methoxy-1-oxo-4-(phenylsulfamoyl)butan-2-yl]carbamic acid (PubChem CID 68792270) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is [(2S)-1-methoxy-1-oxo-4-(phenylsulfamoyl)butan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-methoxy-1-oxo-4-(phenylsulfamoyl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68792270 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [(2S)-1-methoxy-1-oxo-4-(phenylsulfamoyl)butan-2-yl]carbamic acid |
| SMILES | COC(=O)[C@H](CCS(=O)(=O)Nc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C12H16N2O6S/c1-20-11(15)10(13-12(16)17)7-8-21(18,19)14-9-5-3-2-4-6-9/h2-6,10,13-14H,7-8H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | UJJAWLGOQVFRHC-JTQLQIEISA-N |
| XLogP | 0.63 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |