About 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile
2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile (PubChem CID 68792997) has the molecular formula C11H8F2N2O2
and a molecular weight of 238.19 g/mol. Its IUPAC name is 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile |
| PubChem CID | 68792997 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1C[C@H](O)C(F)(F)C1=O |
| InChI | InChI=1S/C11H8F2N2O2/c12-11(13)9(16)6-15(10(11)17)8-4-2-1-3-7(8)5-14/h1-4,9,16H,6H2/t9-/m0/s1 |
| InChIKey | VBHUFVATWPTJFA-VIFPVBQESA-N |
| XLogP | 0.90 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile?
The IUPAC name of 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile (CID 68792997) is 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile.
What is the SMILES notation for 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile?
The canonical SMILES for 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile is N#Cc1ccccc1N1C[C@H](O)C(F)(F)C1=O.
What is the InChIKey of 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile?
The InChIKey is VBHUFVATWPTJFA-VIFPVBQESA-N. The full InChI is InChI=1S/C11H8F2N2O2/c12-11(13)9(16)6-15(10(11)17)8-4-2-1-3-7(8)5-14/h1-4,9,16H,6H2/t9-/m0/s1.
What are the key properties of 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile?
2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile has a molecular weight of 238.19 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-3,3-difluoro-4-hydroxy-2-oxopyrrolidin-1-yl]benzonitrile is sourced from PubChem (CID 68792997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).