C13H12F3NO2 — CID 68794491
methyl 3-[2-prop-2-enyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoate (PubChem CID 68794491) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is methyl 3-[2-prop-2-enyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-[2-prop-2-enyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 68794491 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl 3-[2-prop-2-enyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoate |
| SMILES | C=CCc1nc(C(F)(F)F)ccc1C=CC(=O)OC |
| InChI | InChI=1S/C13H12F3NO2/c1-3-4-10-9(6-8-12(18)19-2)5-7-11(17-10)13(14,15)16/h3,5-8H,1,4H2,2H3 |
| InChIKey | MMLMSWIXMNVPEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|