C22H26F3N3O2S — CID 143617676
(E)-N-[(4-aminophenyl)methyl]-3-[2-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide;hydroxysulfanylethene (PubChem CID 143617676) has the molecular formula C22H26F3N3O2S and a molecular weight of 453.53 g/mol. Its IUPAC name is (E)-N-[(4-aminophenyl)methyl]-3-[2-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide;hydroxysulfanylethene.
| Compound Name | (E)-N-[(4-aminophenyl)methyl]-3-[2-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide;hydroxysulfanylethene |
|---|---|
| PubChem CID | 143617676 |
| Molecular Formula | C22H26F3N3O2S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (E)-N-[(4-aminophenyl)methyl]-3-[2-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide;hydroxysulfanylethene |
| SMILES | C=CSO.CC(C)Cc1nc(C(F)(F)F)ccc1/C=C/C(=O)NCc1ccc(N)cc1 |
| InChI | InChI=1S/C20H22F3N3O.C2H4OS/c1-13(2)11-17-15(5-9-18(26-17)20(21,22)23)6-10-19(27)25-12-14-3-7-16(24)8-4-14;1-2-4-3/h3-10,13H,11-12,24H2,1-2H3,(H,25,27);2-3H,1H2/b10-6+; |
| InChIKey | YKRZPZUECHPBBY-AAGWESIMSA-N |
| XLogP | 5.55 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|