C20H20F5N3O — CID 89302042
(E)-N-[(4-amino-3,5-difluorophenyl)methyl]-3-[2-butan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 89302042) has the molecular formula C20H20F5N3O and a molecular weight of 413.39 g/mol. Its IUPAC name is (E)-N-[(4-amino-3,5-difluorophenyl)methyl]-3-[2-butan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-amino-3,5-difluorophenyl)methyl]-3-[2-butan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 89302042 |
| Molecular Formula | C20H20F5N3O |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (E)-N-[(4-amino-3,5-difluorophenyl)methyl]-3-[2-butan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | CCC(C)c1nc(C(F)(F)F)ccc1/C=C/C(=O)NCc1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C20H20F5N3O/c1-3-11(2)19-13(4-6-16(28-19)20(23,24)25)5-7-17(29)27-10-12-8-14(21)18(26)15(22)9-12/h4-9,11H,3,10,26H2,1-2H3,(H,27,29)/b7-5+ |
| InChIKey | RPMCLBCYNCLXCC-FNORWQNLSA-N |
| XLogP | 4.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|