C24H22Cl2N4O4S — CID 68798302
[3-[(1-carbamimidoylpiperidin-4-yl)-(2,4-dichlorobenzoyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68798302) has the molecular formula C24H22Cl2N4O4S and a molecular weight of 533.44 g/mol. Its IUPAC name is [3-[(1-carbamimidoylpiperidin-4-yl)-(2,4-dichlorobenzoyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
| Compound Name | [3-[(1-carbamimidoylpiperidin-4-yl)-(2,4-dichlorobenzoyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68798302 |
| Molecular Formula | C24H22Cl2N4O4S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | [3-[(1-carbamimidoylpiperidin-4-yl)-(2,4-dichlorobenzoyl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | [H]/N=C(\N)N1CCC(N(C(=O)c2ccc(Cl)cc2Cl)c2cc(-c3ccccc3)sc2OC(=O)O)CC1 |
| InChI | InChI=1S/C24H22Cl2N4O4S/c25-15-6-7-17(18(26)12-15)21(31)30(16-8-10-29(11-9-16)23(27)28)19-13-20(14-4-2-1-3-5-14)35-22(19)34-24(32)33/h1-7,12-13,16H,8-11H2,(H3,27,28)(H,32,33) |
| InChIKey | BPGCZIZJRQHOKK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|