C27H30F4N4NaO5 — CID 68799464
CID 68799464 (PubChem CID 68799464) has the molecular formula C27H30F4N4NaO5 and a molecular weight of 589.54 g/mol.
| Compound Name | CID 68799464 |
|---|---|
| PubChem CID | 68799464 |
| Molecular Formula | C27H30F4N4NaO5 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1c(C(=O)NCc2ccc(C(F)(F)F)cn2)nn(-c2ccc(F)cc2)c1CC[C@@H](O)C[C@@H](O)CC(=O)O.[Na] |
| InChI | InChI=1S/C27H30F4N4O5.Na/c1-15(2)24-22(10-9-20(36)11-21(37)12-23(38)39)35(19-7-4-17(28)5-8-19)34-25(24)26(40)33-14-18-6-3-16(13-32-18)27(29,30)31;/h3-8,13,15,20-21,36-37H,9-12,14H2,1-2H3,(H,33,40)(H,38,39);/t20-,21-;/m1./s1 |
| InChIKey | WYAFKUVJZXSKSS-MUCZFFFMSA-N |
| XLogP | 3.62 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |