C20H24N2O4 — CID 68802439
(2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylanilino]propanoic acid (PubChem CID 68802439) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylanilino]propanoic acid.
| Compound Name | (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylanilino]propanoic acid |
|---|---|
| PubChem CID | 68802439 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylanilino]propanoic acid |
| SMILES | C[C@H](Nc1cccc(-c2ccccc2)c1NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H24N2O4/c1-13(18(23)24)21-16-12-8-11-15(14-9-6-5-7-10-14)17(16)22-19(25)26-20(2,3)4/h5-13,21H,1-4H3,(H,22,25)(H,23,24)/t13-/m0/s1 |
| InChIKey | QAWFNULIQDLVSZ-ZDUSSCGKSA-N |
| XLogP | 4.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |