C22H22ClN5O5 — CID 68805264
(2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide (PubChem CID 68805264) has the molecular formula C22H22ClN5O5 and a molecular weight of 471.90 g/mol. Its IUPAC name is (2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 68805264 |
| Molecular Formula | C22H22ClN5O5 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)Nc2ccc(N3C(=O)CCC3=O)cc2)N(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C22H22ClN5O5/c1-33-16-10-17(27(12-16)22(32)26-18-7-2-13(23)11-24-18)21(31)25-14-3-5-15(6-4-14)28-19(29)8-9-20(28)30/h2-7,11,16-17H,8-10,12H2,1H3,(H,25,31)(H,24,26,32)/t16-,17-/m1/s1 |
| InChIKey | OKLHGOYZJULMGD-IAGOWNOFSA-N |
| XLogP | 2.65 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|