C25H32ClN5O3 — CID 143578123
1-N-(5-chloro-2-pyridinyl)-2-N-(1-ethyl-2-methyl-1,3,4,9-tetrahydrocyclohepta[c]pyridin-6-yl)-4-methoxypyrrolidine-1,2-dicarboxamide (PubChem CID 143578123) has the molecular formula C25H32ClN5O3 and a molecular weight of 486.02 g/mol. Its IUPAC name is 1-N-(5-chloro-2-pyridinyl)-2-N-(1-ethyl-2-methyl-1,3,4,9-tetrahydrocyclohepta[c]pyridin-6-yl)-4-methoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(5-chloro-2-pyridinyl)-2-N-(1-ethyl-2-methyl-1,3,4,9-tetrahydrocyclohepta[c]pyridin-6-yl)-4-methoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 143578123 |
| Molecular Formula | C25H32ClN5O3 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-N-(5-chloro-2-pyridinyl)-2-N-(1-ethyl-2-methyl-1,3,4,9-tetrahydrocyclohepta[c]pyridin-6-yl)-4-methoxypyrrolidine-1,2-dicarboxamide |
| SMILES | CCC1C2=C(C=C(NC(=O)C3CC(OC)CN3C(=O)Nc3ccc(Cl)cn3)C=CC2)CCN1C |
| InChI | InChI=1S/C25H32ClN5O3/c1-4-21-20-7-5-6-18(12-16(20)10-11-30(21)2)28-24(32)22-13-19(34-3)15-31(22)25(33)29-23-9-8-17(26)14-27-23/h5-6,8-9,12,14,19,21-22H,4,7,10-11,13,15H2,1-3H3,(H,28,32)(H,27,29,33) |
| InChIKey | PVDOQFKCNSBSOX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |