C24H19ClF4N6O6 — CID 87582595
(2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[2-fluoro-4-[3-nitro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide (PubChem CID 87582595) has the molecular formula C24H19ClF4N6O6 and a molecular weight of 598.90 g/mol. Its IUPAC name is (2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[2-fluoro-4-[3-nitro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[2-fluoro-4-[3-nitro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87582595 |
| Molecular Formula | C24H19ClF4N6O6 |
| Molecular Weight | 598.90 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | (2R,4R)-1-N-(5-chloro-2-pyridinyl)-2-N-[2-fluoro-4-[3-nitro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)Nc2ccc(-n3cc(C(F)(F)F)cc([N+](=O)[O-])c3=O)cc2F)N(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C24H19ClF4N6O6/c1-41-15-8-18(34(11-15)23(38)32-20-5-2-13(25)9-30-20)21(36)31-17-4-3-14(7-16(17)26)33-10-12(24(27,28)29)6-19(22(33)37)35(39)40/h2-7,9-10,15,18H,8,11H2,1H3,(H,31,36)(H,30,32,38)/t15-,18-/m1/s1 |
| InChIKey | XFGHGTDOHXGUGW-CRAIPNDOSA-N |
| XLogP | 4.21 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|