C25H23ClFN5O6 — CID 87736921
(2R,4R)-1-N-(4-chlorophenyl)-2-N-[2-fluoro-4-(4-methyl-3-nitro-2-oxo-1-pyridinyl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide (PubChem CID 87736921) has the molecular formula C25H23ClFN5O6 and a molecular weight of 543.94 g/mol. Its IUPAC name is (2R,4R)-1-N-(4-chlorophenyl)-2-N-[2-fluoro-4-(4-methyl-3-nitro-2-oxo-1-pyridinyl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-N-(4-chlorophenyl)-2-N-[2-fluoro-4-(4-methyl-3-nitro-2-oxo-1-pyridinyl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87736921 |
| Molecular Formula | C25H23ClFN5O6 |
| Molecular Weight | 543.94 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | (2R,4R)-1-N-(4-chlorophenyl)-2-N-[2-fluoro-4-(4-methyl-3-nitro-2-oxo-1-pyridinyl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)Nc2ccc(-n3ccc(C)c([N+](=O)[O-])c3=O)cc2F)N(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H23ClFN5O6/c1-14-9-10-30(24(34)22(14)32(36)37)17-7-8-20(19(27)11-17)29-23(33)21-12-18(38-2)13-31(21)25(35)28-16-5-3-15(26)4-6-16/h3-11,18,21H,12-13H2,1-2H3,(H,28,35)(H,29,33)/t18-,21-/m1/s1 |
| InChIKey | RVBCUXKTIAWHGA-WIYYLYMNSA-N |
| XLogP | 4.11 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.94 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|