C30H28ClFN4O5 — CID 68913283
(2R,4R)-2-N-[4-(3-benzoyl-2-oxopyrrolidin-1-yl)-2-fluorophenyl]-1-N-(4-chlorophenyl)-4-methoxypyrrolidine-1,2-dicarboxamide (PubChem CID 68913283) has the molecular formula C30H28ClFN4O5 and a molecular weight of 579.03 g/mol. Its IUPAC name is (2R,4R)-2-N-[4-(3-benzoyl-2-oxopyrrolidin-1-yl)-2-fluorophenyl]-1-N-(4-chlorophenyl)-4-methoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-2-N-[4-(3-benzoyl-2-oxopyrrolidin-1-yl)-2-fluorophenyl]-1-N-(4-chlorophenyl)-4-methoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 68913283 |
| Molecular Formula | C30H28ClFN4O5 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | (2R,4R)-2-N-[4-(3-benzoyl-2-oxopyrrolidin-1-yl)-2-fluorophenyl]-1-N-(4-chlorophenyl)-4-methoxypyrrolidine-1,2-dicarboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)Nc2ccc(N3CCC(C(=O)c4ccccc4)C3=O)cc2F)N(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C30H28ClFN4O5/c1-41-22-16-26(36(17-22)30(40)33-20-9-7-19(31)8-10-20)28(38)34-25-12-11-21(15-24(25)32)35-14-13-23(29(35)39)27(37)18-5-3-2-4-6-18/h2-12,15,22-23,26H,13-14,16-17H2,1H3,(H,33,40)(H,34,38)/t22-,23?,26-/m1/s1 |
| InChIKey | MANYSRSZWTWWNL-NAMMGXCXSA-N |
| XLogP | 4.97 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|