C21H17BrCl2N2O2S — CID 68805391
(5R,6S)-3-(1-bromoethyl)-5,6-bis(4-chlorophenyl)-6-methyl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 68805391) has the molecular formula C21H17BrCl2N2O2S and a molecular weight of 512.26 g/mol. Its IUPAC name is (5R,6S)-3-(1-bromoethyl)-5,6-bis(4-chlorophenyl)-6-methyl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
| Compound Name | (5R,6S)-3-(1-bromoethyl)-5,6-bis(4-chlorophenyl)-6-methyl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 68805391 |
| Molecular Formula | C21H17BrCl2N2O2S |
| Molecular Weight | 512.26 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | (5R,6S)-3-(1-bromoethyl)-5,6-bis(4-chlorophenyl)-6-methyl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| SMILES | CC(Br)C1=C(C(=O)O)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C21H17BrCl2N2O2S/c1-11(22)16-17(19(27)28)29-20-25-21(2,13-5-9-15(24)10-6-13)18(26(16)20)12-3-7-14(23)8-4-12/h3-11,18H,1-2H3,(H,27,28)/t11?,18-,21+/m1/s1 |
| InChIKey | VHVCERGERBHNTK-YVMZCOFLSA-N |
| XLogP | 6.45 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.26 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|