C28H32Cl2N4OS — CID 58006775
(5R,6S)-N-(azetidin-3-yl)-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006775) has the molecular formula C28H32Cl2N4OS and a molecular weight of 543.56 g/mol. Its IUPAC name is (5R,6S)-N-(azetidin-3-yl)-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-N-(azetidin-3-yl)-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006775 |
| Molecular Formula | C28H32Cl2N4OS |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (5R,6S)-N-(azetidin-3-yl)-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(C(C)C)C2CNC2)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C28H32Cl2N4OS/c1-16(2)23-24(26(35)33(17(3)4)22-14-31-15-22)36-27-32-28(5,19-8-12-21(30)13-9-19)25(34(23)27)18-6-10-20(29)11-7-18/h6-13,16-17,22,25,31H,14-15H2,1-5H3/t25-,28+/m1/s1 |
| InChIKey | DDBZKLSODIOCLR-NAKRPHOHSA-N |
| XLogP | 6.44 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |