C30H36Cl2N4OS — CID 143692071
(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[(1-methylazetidin-2-yl)methyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 143692071) has the molecular formula C30H36Cl2N4OS and a molecular weight of 571.62 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[(1-methylazetidin-2-yl)methyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[(1-methylazetidin-2-yl)methyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 143692071 |
| Molecular Formula | C30H36Cl2N4OS |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[(1-methylazetidin-2-yl)methyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CC2CCN2C)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C30H36Cl2N4OS/c1-18(2)25-26(28(37)35(19(3)4)17-24-15-16-34(24)6)38-29-33-30(5,21-9-13-23(32)14-10-21)27(36(25)29)20-7-11-22(31)12-8-20/h7-14,18-19,24,27H,15-17H2,1-6H3/t24?,27-,30+/m1/s1 |
| InChIKey | YWWUFQBOMINCQJ-PTVMHFHWSA-N |
| XLogP | 7.18 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |