C33H41Cl2N5O2S — CID 58006827
(5R,6S)-5,6-bis(4-chlorophenyl)-N-[2-[(3R)-3,4-dimethylpiperazin-1-yl]-2-oxoethyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006827) has the molecular formula C33H41Cl2N5O2S and a molecular weight of 642.70 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-N-[2-[(3R)-3,4-dimethylpiperazin-1-yl]-2-oxoethyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[2-[(3R)-3,4-dimethylpiperazin-1-yl]-2-oxoethyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006827 |
| Molecular Formula | C33H41Cl2N5O2S |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[2-[(3R)-3,4-dimethylpiperazin-1-yl]-2-oxoethyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CC(=O)N2CCN(C)[C@H](C)C2)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C33H41Cl2N5O2S/c1-20(2)28-29(31(42)39(21(3)4)19-27(41)38-17-16-37(7)22(5)18-38)43-32-36-33(6,24-10-14-26(35)15-11-24)30(40(28)32)23-8-12-25(34)13-9-23/h8-15,20-22,30H,16-19H2,1-7H3/t22-,30-,33+/m1/s1 |
| InChIKey | QGMJXPIRLNEVCK-WKGIXAQJSA-N |
| XLogP | 6.64 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |