C35H49Cl2N3O3SSi — CID 58006856
(5R,6S)-N-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006856) has the molecular formula C35H49Cl2N3O3SSi and a molecular weight of 690.85 g/mol. Its IUPAC name is (5R,6S)-N-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-N-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006856 |
| Molecular Formula | C35H49Cl2N3O3SSi |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | (5R,6S)-N-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CC[C@H](O)CO[Si](C)(C)C(C)(C)C)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C35H49Cl2N3O3SSi/c1-22(2)29-30(32(42)39(23(3)4)20-19-28(41)21-43-45(9,10)34(5,6)7)44-33-38-35(8,25-13-17-27(37)18-14-25)31(40(29)33)24-11-15-26(36)16-12-24/h11-18,22-23,28,31,41H,19-21H2,1-10H3/t28-,31+,35-/m0/s1 |
| InChIKey | ZRIVEHHGNPMGQN-NLTSOJRXSA-N |
| XLogP | 9.25 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|