C36H49Cl2N3O3SSi — CID 58006819
(5R,6S)-N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006819) has the molecular formula C36H49Cl2N3O3SSi and a molecular weight of 702.87 g/mol. Its IUPAC name is (5R,6S)-N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006819 |
| Molecular Formula | C36H49Cl2N3O3SSi |
| Molecular Weight | 702.87 g/mol |
| Exact Mass | 701.26 |
| IUPAC Name | (5R,6S)-N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methyl]-5,6-bis(4-chlorophenyl)-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CC2(CO[Si](C)(C)C(C)(C)C)COC2)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C36H49Cl2N3O3SSi/c1-23(2)29-30(32(42)40(24(3)4)19-36(20-43-21-36)22-44-46(9,10)34(5,6)7)45-33-39-35(8,26-13-17-28(38)18-14-26)31(41(29)33)25-11-15-27(37)16-12-25/h11-18,23-24,31H,19-22H2,1-10H3/t31-,35+/m1/s1 |
| InChIKey | NWLPAUMIEUOAFR-NQVJXQQZSA-N |
| XLogP | 9.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.87 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|