C29H34Cl2N4O2S — CID 58007384
(5R,6S)-N-[(2S)-1-[acetyl(methyl)amino]propan-2-yl]-5,6-bis(4-chlorophenyl)-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58007384) has the molecular formula C29H34Cl2N4O2S and a molecular weight of 573.59 g/mol. Its IUPAC name is (5R,6S)-N-[(2S)-1-[acetyl(methyl)amino]propan-2-yl]-5,6-bis(4-chlorophenyl)-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-N-[(2S)-1-[acetyl(methyl)amino]propan-2-yl]-5,6-bis(4-chlorophenyl)-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58007384 |
| Molecular Formula | C29H34Cl2N4O2S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | (5R,6S)-N-[(2S)-1-[acetyl(methyl)amino]propan-2-yl]-5,6-bis(4-chlorophenyl)-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(=O)N(C)C[C@H](C)N(C)C(=O)C1=C(C(C)C)N2C(=N[C@@](C)(c3ccc(Cl)cc3)[C@H]2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C29H34Cl2N4O2S/c1-17(2)24-25(27(37)34(7)18(3)16-33(6)19(4)36)38-28-32-29(5,21-10-14-23(31)15-11-21)26(35(24)28)20-8-12-22(30)13-9-20/h8-15,17-18,26H,16H2,1-7H3/t18-,26+,29-/m0/s1 |
| InChIKey | ORDCMGLFRMAVJE-YSFPHSKWSA-N |
| XLogP | 6.56 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |