C29H22FN5O2 — CID 68806587
2-fluoro-N-[(3R)-oxolan-3-yl]-4-[3-(1-quinolin-6-ylcycloprop-2-en-1-yl)imidazo[1,2-a]pyrimidin-6-yl]benzamide (PubChem CID 68806587) has the molecular formula C29H22FN5O2 and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-fluoro-N-[(3R)-oxolan-3-yl]-4-[3-(1-quinolin-6-ylcycloprop-2-en-1-yl)imidazo[1,2-a]pyrimidin-6-yl]benzamide.
| Compound Name | 2-fluoro-N-[(3R)-oxolan-3-yl]-4-[3-(1-quinolin-6-ylcycloprop-2-en-1-yl)imidazo[1,2-a]pyrimidin-6-yl]benzamide |
|---|---|
| PubChem CID | 68806587 |
| Molecular Formula | C29H22FN5O2 |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-fluoro-N-[(3R)-oxolan-3-yl]-4-[3-(1-quinolin-6-ylcycloprop-2-en-1-yl)imidazo[1,2-a]pyrimidin-6-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCOC1)c1ccc(-c2cnc3ncc(C4(c5ccc6ncccc6c5)C=C4)n3c2)cc1F |
| InChI | InChI=1S/C29H22FN5O2/c30-24-13-18(3-5-23(24)27(36)34-22-7-11-37-17-22)20-14-32-28-33-15-26(35(28)16-20)29(8-9-29)21-4-6-25-19(12-21)2-1-10-31-25/h1-6,8-10,12-16,22H,7,11,17H2,(H,34,36)/t22-/m1/s1 |
| InChIKey | SBNGWOCHIUHJPZ-JOCHJYFZSA-N |
| XLogP | 4.46 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|