About [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate
[(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate (PubChem CID 68807567) has the molecular formula C14H18ClNO3
and a molecular weight of 283.76 g/mol. Its IUPAC name is [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate.
Analyze [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate?
The IUPAC name of [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate (CID 68807567) is [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate.
What is the SMILES notation for [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate?
The canonical SMILES for [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate is COC(=O)O[C@H]1CN(C)CC[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate?
The InChIKey is BWNNRTICJSSSQN-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H18ClNO3/c1-16-8-7-12(10-3-5-11(15)6-4-10)13(9-16)19-14(17)18-2/h3-6,12-13H,7-9H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate?
[(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate has a molecular weight of 283.76 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl] methyl carbonate is sourced from PubChem (CID 68807567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).