C15H21ClN2O3S — CID 11382361
2-[[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfinyl]-N-hydroxyacetamide (PubChem CID 11382361) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is 2-[[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfinyl]-N-hydroxyacetamide.
| Compound Name | 2-[[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfinyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 11382361 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfinyl]-N-hydroxyacetamide |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CS(=O)CC(=O)NO)C1 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-18-7-6-14(11-2-4-13(16)5-3-11)12(8-18)9-22(21)10-15(19)17-20/h2-5,12,14,20H,6-10H2,1H3,(H,17,19)/t12-,14-,22?/m1/s1 |
| InChIKey | IDGXSXYPWWIJPY-PBDXTPLQSA-N |
| XLogP | 1.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|